C7H10N2O — CID 163865880
2,5-diaminocyclohepta-1,3,6-trien-1-ol (PubChem CID 163865880) has the molecular formula C7H10N2O and a molecular weight of 138.17 g/mol. Its IUPAC name is 2,5-diaminocyclohepta-1,3,6-trien-1-ol.
| Compound Name | 2,5-diaminocyclohepta-1,3,6-trien-1-ol |
|---|---|
| PubChem CID | 163865880 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 2,5-diaminocyclohepta-1,3,6-trien-1-ol |
| SMILES | NC1=C(O)C=CC(N)C=C1 |
| InChI | InChI=1S/C7H10N2O/c8-5-1-3-6(9)7(10)4-2-5/h1-5,10H,8-9H2 |
| InChIKey | PGONEBHRKCXYGC-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |