C11H13NO — CID 163587315
(1E,3Z,7S,8Z,10Z)-7-aminocycloundeca-1,3,5,8,10-pentaen-1-ol (PubChem CID 163587315) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is (1E,3Z,7S,8Z,10Z)-7-aminocycloundeca-1,3,5,8,10-pentaen-1-ol.
| Compound Name | (1E,3Z,7S,8Z,10Z)-7-aminocycloundeca-1,3,5,8,10-pentaen-1-ol |
|---|---|
| PubChem CID | 163587315 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | (1E,3Z,7S,8Z,10Z)-7-aminocycloundeca-1,3,5,8,10-pentaen-1-ol |
| SMILES | N[C@H]1C=C/C=C\C=C(O)/C=C\C=C/1 |
| InChI | InChI=1S/C11H13NO/c12-10-6-2-1-3-8-11(13)9-5-4-7-10/h1-10,13H,12H2/b3-1-,6-2?,7-4-,9-5-,11-8+/t10-/m0/s1 |
| InChIKey | GMOCOCZQBUGHQA-RTKGAKDTSA-N |
| XLogP | 1.99 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |