C18H26O5 — CID 163866736
2-[(5-oxo-4-oxatetracyclo[4.3.1.03,10.08,10]decan-1-yl)oxy]ethyl 2,2-dimethylpentanoate (PubChem CID 163866736) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is 2-[(5-oxo-4-oxatetracyclo[4.3.1.03,10.08,10]decan-1-yl)oxy]ethyl 2,2-dimethylpentanoate.
| Compound Name | 2-[(5-oxo-4-oxatetracyclo[4.3.1.03,10.08,10]decan-1-yl)oxy]ethyl 2,2-dimethylpentanoate |
|---|---|
| PubChem CID | 163866736 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 2-[(5-oxo-4-oxatetracyclo[4.3.1.03,10.08,10]decan-1-yl)oxy]ethyl 2,2-dimethylpentanoate |
| SMILES | CCCC(C)(C)C(=O)OCCOC12CC3CC4C(=O)OC(C1)C342 |
| InChI | InChI=1S/C18H26O5/c1-4-5-16(2,3)15(20)21-6-7-22-17-9-11-8-12-14(19)23-13(10-17)18(11,12)17/h11-13H,4-10H2,1-3H3 |
| InChIKey | PHHCNYGTMLNDSQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|