C14H19F3N2O2 — CID 163867657
1-ethoxy-2-[3-(trifluoromethyl)spiro[6,7-dihydro-5H-indazole-4,1'-cyclopropane]-1-yl]ethanol (PubChem CID 163867657) has the molecular formula C14H19F3N2O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is 1-ethoxy-2-[3-(trifluoromethyl)spiro[6,7-dihydro-5H-indazole-4,1'-cyclopropane]-1-yl]ethanol.
| Compound Name | 1-ethoxy-2-[3-(trifluoromethyl)spiro[6,7-dihydro-5H-indazole-4,1'-cyclopropane]-1-yl]ethanol |
|---|---|
| PubChem CID | 163867657 |
| Molecular Formula | C14H19F3N2O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 1-ethoxy-2-[3-(trifluoromethyl)spiro[6,7-dihydro-5H-indazole-4,1'-cyclopropane]-1-yl]ethanol |
| SMILES | CCOC(O)Cn1nc(C(F)(F)F)c2c1CCCC21CC1 |
| InChI | InChI=1S/C14H19F3N2O2/c1-2-21-10(20)8-19-9-4-3-5-13(6-7-13)11(9)12(18-19)14(15,16)17/h10,20H,2-8H2,1H3 |
| InChIKey | PIBDITYYKRLRRP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|