C14H22N4O3 — CID 163868392
2-(tert-butylamino)-5-(pyrazine-2-carbonylamino)pentanoic acid (PubChem CID 163868392) has the molecular formula C14H22N4O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-(tert-butylamino)-5-(pyrazine-2-carbonylamino)pentanoic acid.
| Compound Name | 2-(tert-butylamino)-5-(pyrazine-2-carbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 163868392 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2-(tert-butylamino)-5-(pyrazine-2-carbonylamino)pentanoic acid |
| SMILES | CC(C)(C)NC(CCCNC(=O)c1cnccn1)C(=O)O |
| InChI | InChI=1S/C14H22N4O3/c1-14(2,3)18-10(13(20)21)5-4-6-17-12(19)11-9-15-7-8-16-11/h7-10,18H,4-6H2,1-3H3,(H,17,19)(H,20,21) |
| InChIKey | PIQZWOJFMRXMKQ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|