C16H22N2O2S — CID 163870826
tert-butyl N-[2-amino-4-(3-methyl-2,3-dihydrothiophen-2-yl)phenyl]carbamate (PubChem CID 163870826) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is tert-butyl N-[2-amino-4-(3-methyl-2,3-dihydrothiophen-2-yl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-amino-4-(3-methyl-2,3-dihydrothiophen-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 163870826 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | tert-butyl N-[2-amino-4-(3-methyl-2,3-dihydrothiophen-2-yl)phenyl]carbamate |
| SMILES | CC1C=CSC1c1ccc(NC(=O)OC(C)(C)C)c(N)c1 |
| InChI | InChI=1S/C16H22N2O2S/c1-10-7-8-21-14(10)11-5-6-13(12(17)9-11)18-15(19)20-16(2,3)4/h5-10,14H,17H2,1-4H3,(H,18,19) |
| InChIKey | PKQGWDCWYNAIEB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|