About tert-butyl N-[2-amino-4-(3-methyl-2,3-dihydrothiophen-2-yl)phenyl]carbamate
tert-butyl N-[2-amino-4-(3-methyl-2,3-dihydrothiophen-2-yl)phenyl]carbamate (PubChem CID 163870826) has the molecular formula C16H22N2O2S
and a molecular weight of 306.43 g/mol. Its IUPAC name is tert-butyl N-[2-amino-4-(3-methyl-2,3-dihydrothiophen-2-yl)phenyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-amino-4-(3-methyl-2,3-dihydrothiophen-2-yl)phenyl]carbamate |
| PubChem CID | 163870826 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | tert-butyl N-[2-amino-4-(3-methyl-2,3-dihydrothiophen-2-yl)phenyl]carbamate |
| SMILES | CC1C=CSC1c1ccc(NC(=O)OC(C)(C)C)c(N)c1 |
| InChI | InChI=1S/C16H22N2O2S/c1-10-7-8-21-14(10)11-5-6-13(12(17)9-11)18-15(19)20-16(2,3)4/h5-10,14H,17H2,1-4H3,(H,18,19) |
| InChIKey | PKQGWDCWYNAIEB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[2-amino-4-(3-methyl-2,3-dihydrothiophen-2-yl)phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-amino-4-(3-methyl-2,3-dihydrothiophen-2-yl)phenyl]carbamate?
The IUPAC name of tert-butyl N-[2-amino-4-(3-methyl-2,3-dihydrothiophen-2-yl)phenyl]carbamate (CID 163870826) is tert-butyl N-[2-amino-4-(3-methyl-2,3-dihydrothiophen-2-yl)phenyl]carbamate.
What is the SMILES notation for tert-butyl N-[2-amino-4-(3-methyl-2,3-dihydrothiophen-2-yl)phenyl]carbamate?
The canonical SMILES for tert-butyl N-[2-amino-4-(3-methyl-2,3-dihydrothiophen-2-yl)phenyl]carbamate is CC1C=CSC1c1ccc(NC(=O)OC(C)(C)C)c(N)c1.
What is the InChIKey of tert-butyl N-[2-amino-4-(3-methyl-2,3-dihydrothiophen-2-yl)phenyl]carbamate?
The InChIKey is PKQGWDCWYNAIEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O2S/c1-10-7-8-21-14(10)11-5-6-13(12(17)9-11)18-15(19)20-16(2,3)4/h5-10,14H,17H2,1-4H3,(H,18,19).
What are the key properties of tert-butyl N-[2-amino-4-(3-methyl-2,3-dihydrothiophen-2-yl)phenyl]carbamate?
tert-butyl N-[2-amino-4-(3-methyl-2,3-dihydrothiophen-2-yl)phenyl]carbamate has a molecular weight of 306.43 g/mol, XLogP of 4.55, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-amino-4-(3-methyl-2,3-dihydrothiophen-2-yl)phenyl]carbamate is sourced from PubChem (CID 163870826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).