C32H42ClN3O2S — CID 163872440
(E)-N-[2-[2-[2-(6-chlorohexyl)cyclopropyl]ethoxy]ethyl]-2-cyano-3-[6-(dimethylamino)-4,4-dimethylindeno[1,2-b]thiophen-2-yl]prop-2-enamide (PubChem CID 163872440) has the molecular formula C32H42ClN3O2S and a molecular weight of 568.23 g/mol. Its IUPAC name is (E)-N-[2-[2-[2-(6-chlorohexyl)cyclopropyl]ethoxy]ethyl]-2-cyano-3-[6-(dimethylamino)-4,4-dimethylindeno[1,2-b]thiophen-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[2-[2-[2-(6-chlorohexyl)cyclopropyl]ethoxy]ethyl]-2-cyano-3-[6-(dimethylamino)-4,4-dimethylindeno[1,2-b]thiophen-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 163872440 |
| Molecular Formula | C32H42ClN3O2S |
| Molecular Weight | 568.23 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | (E)-N-[2-[2-[2-(6-chlorohexyl)cyclopropyl]ethoxy]ethyl]-2-cyano-3-[6-(dimethylamino)-4,4-dimethylindeno[1,2-b]thiophen-2-yl]prop-2-enamide |
| SMILES | CN(C)c1ccc2c(c1)C(C)(C)c1cc(/C=C(\C#N)C(=O)NCCOCCC3CC3CCCCCCCl)sc1-2 |
| InChI | InChI=1S/C32H42ClN3O2S/c1-32(2)28-19-25(36(3)4)10-11-27(28)30-29(32)20-26(39-30)18-24(21-34)31(37)35-14-16-38-15-12-23-17-22(23)9-7-5-6-8-13-33/h10-11,18-20,22-23H,5-9,12-17H2,1-4H3,(H,35,37)/b24-18+ |
| InChIKey | PLZUWJNFSFKATH-HKOYGPOVSA-N |
| XLogP | 7.38 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.23 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|