About 2-cyclohexyl-6-cyclooctylimidazo[2,1-b][1,3,4]thiadiazole
2-cyclohexyl-6-cyclooctylimidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 163872627) has the molecular formula C18H27N3S
and a molecular weight of 317.50 g/mol. Its IUPAC name is 2-cyclohexyl-6-cyclooctylimidazo[2,1-b][1,3,4]thiadiazole.
Molecular Properties
| Compound Name | 2-cyclohexyl-6-cyclooctylimidazo[2,1-b][1,3,4]thiadiazole |
| PubChem CID | 163872627 |
| Molecular Formula | C18H27N3S |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 2-cyclohexyl-6-cyclooctylimidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | c1c(C2CCCCCCC2)nc2sc(C3CCCCC3)nn12 |
| InChI | InChI=1S/C18H27N3S/c1-2-5-9-14(10-6-3-1)16-13-21-18(19-16)22-17(20-21)15-11-7-4-8-12-15/h13-15H,1-12H2 |
| InChIKey | PMEJOWUOMYGTIC-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyclohexyl-6-cyclooctylimidazo[2,1-b][1,3,4]thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-6-cyclooctylimidazo[2,1-b][1,3,4]thiadiazole?
The IUPAC name of 2-cyclohexyl-6-cyclooctylimidazo[2,1-b][1,3,4]thiadiazole (CID 163872627) is 2-cyclohexyl-6-cyclooctylimidazo[2,1-b][1,3,4]thiadiazole.
What is the SMILES notation for 2-cyclohexyl-6-cyclooctylimidazo[2,1-b][1,3,4]thiadiazole?
The canonical SMILES for 2-cyclohexyl-6-cyclooctylimidazo[2,1-b][1,3,4]thiadiazole is c1c(C2CCCCCCC2)nc2sc(C3CCCCC3)nn12.
What is the InChIKey of 2-cyclohexyl-6-cyclooctylimidazo[2,1-b][1,3,4]thiadiazole?
The InChIKey is PMEJOWUOMYGTIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N3S/c1-2-5-9-14(10-6-3-1)16-13-21-18(19-16)22-17(20-21)15-11-7-4-8-12-15/h13-15H,1-12H2.
What are the key properties of 2-cyclohexyl-6-cyclooctylimidazo[2,1-b][1,3,4]thiadiazole?
2-cyclohexyl-6-cyclooctylimidazo[2,1-b][1,3,4]thiadiazole has a molecular weight of 317.50 g/mol, XLogP of 5.67, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-6-cyclooctylimidazo[2,1-b][1,3,4]thiadiazole is sourced from PubChem (CID 163872627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).