C17H20O6 — CID 163876864
4-(3-oxo-1a,3a,4,5,6,7,7a,7b-octahydrooxireno[2,3-c]isochromen-6-yl)-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione (PubChem CID 163876864) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is 4-(3-oxo-1a,3a,4,5,6,7,7a,7b-octahydrooxireno[2,3-c]isochromen-6-yl)-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione.
| Compound Name | 4-(3-oxo-1a,3a,4,5,6,7,7a,7b-octahydrooxireno[2,3-c]isochromen-6-yl)-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 163876864 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 4-(3-oxo-1a,3a,4,5,6,7,7a,7b-octahydrooxireno[2,3-c]isochromen-6-yl)-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione |
| SMILES | O=C1OC2OC2C2CC(C3CCCC4C(=O)OC(=O)C43)CCC12 |
| InChI | InChI=1S/C17H20O6/c18-14-9-5-4-7(6-11(9)13-17(21-13)23-14)8-2-1-3-10-12(8)16(20)22-15(10)19/h7-13,17H,1-6H2 |
| InChIKey | PPQDTRZDYRVJFA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 82.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|