C11H15I3N- — CID 163877214
CID 163877214 (PubChem CID 163877214) has the molecular formula C11H15I3N- and a molecular weight of 541.96 g/mol.
| Compound Name | CID 163877214 |
|---|---|
| PubChem CID | 163877214 |
| Molecular Formula | C11H15I3N- |
| Molecular Weight | 541.96 g/mol |
| Exact Mass | 541.83 |
| IUPAC Name | — |
| SMILES | C=CC1=C(/C=C\C)N(C)C(CI)[I-]C1I |
| InChI | InChI=1S/C11H15I3N/c1-4-6-9-8(5-2)11(13)14-10(7-12)15(9)3/h4-6,10-11H,2,7H2,1,3H3/q-1/b6-4- |
| InChIKey | MBSQVGGTTXHGBN-XQRVVYSFSA-N |
| XLogP | 0.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.96 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|