C19H40N6O2 — CID 163879018
2-[4-(2,2-dimethylpropyl)-10-ethyl-7-(formamidomethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetamide (PubChem CID 163879018) has the molecular formula C19H40N6O2 and a molecular weight of 384.57 g/mol. Its IUPAC name is 2-[4-(2,2-dimethylpropyl)-10-ethyl-7-(formamidomethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetamide.
| Compound Name | 2-[4-(2,2-dimethylpropyl)-10-ethyl-7-(formamidomethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetamide |
|---|---|
| PubChem CID | 163879018 |
| Molecular Formula | C19H40N6O2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.32 |
| IUPAC Name | 2-[4-(2,2-dimethylpropyl)-10-ethyl-7-(formamidomethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetamide |
| SMILES | CCN1CCN(CNC=O)CCN(CC(C)(C)C)CCN(CC(N)=O)CC1 |
| InChI | InChI=1S/C19H40N6O2/c1-5-22-6-8-23(14-18(20)27)9-10-24(15-19(2,3)4)11-13-25(12-7-22)16-21-17-26/h17H,5-16H2,1-4H3,(H2,20,27)(H,21,26) |
| InChIKey | DZMXDAVLPHJJHR-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|