C20H39N7O4 — CID 155791812
2-[4-(3,3-dimethyl-2-oxobutyl)-7,10-bis(formamidomethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetamide (PubChem CID 155791812) has the molecular formula C20H39N7O4 and a molecular weight of 441.58 g/mol. Its IUPAC name is 2-[4-(3,3-dimethyl-2-oxobutyl)-7,10-bis(formamidomethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetamide.
| Compound Name | 2-[4-(3,3-dimethyl-2-oxobutyl)-7,10-bis(formamidomethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetamide |
|---|---|
| PubChem CID | 155791812 |
| Molecular Formula | C20H39N7O4 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.31 |
| IUPAC Name | 2-[4-(3,3-dimethyl-2-oxobutyl)-7,10-bis(formamidomethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetamide |
| SMILES | CC(C)(C)C(=O)CN1CCN(CNC=O)CCN(CNC=O)CCN(CC(N)=O)CC1 |
| InChI | InChI=1S/C20H39N7O4/c1-20(2,3)18(30)12-24-4-5-25(13-19(21)31)7-9-27(15-23-17-29)11-10-26(8-6-24)14-22-16-28/h16-17H,4-15H2,1-3H3,(H2,21,31)(H,22,28)(H,23,29) |
| InChIKey | WERSIQJAVVGACQ-UHFFFAOYSA-N |
| XLogP | -2.28 |
| TPSA | 131.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|