C19H15FIN6O3S- — CID 163880479
CID 163880479 (PubChem CID 163880479) has the molecular formula C19H15FIN6O3S- and a molecular weight of 553.34 g/mol.
| Compound Name | CID 163880479 |
|---|---|
| PubChem CID | 163880479 |
| Molecular Formula | C19H15FIN6O3S- |
| Molecular Weight | 553.34 g/mol |
| Exact Mass | 553.00 |
| IUPAC Name | — |
| SMILES | CNC(=O)[C@@]12[I-]C1C(n1cnc3c(NC)nc(C#Cc4ccc(F)s4)nc31)=C(O)C2O |
| InChI | InChI=1S/C19H15FIN6O3S/c1-22-16-11-17(26-10(25-16)6-4-8-3-5-9(20)31-8)27(7-24-11)12-13(28)15(29)19(14(12)21-19)18(30)23-2/h3,5,7,14-15,28-29H,1-2H3,(H,23,30)(H,22,25,26)/q-1/t14?,15?,19-/m1/s1 |
| InChIKey | QKQLAUQHGRRALT-JFIBYHEFSA-N |
| XLogP | -2.47 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.34 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|