C12H17N4O2+ — CID 163886350
5-[4-(dimethylamino)but-2-enoylamino]pyridin-1-ium-2-carboxamide (PubChem CID 163886350) has the molecular formula C12H17N4O2+ and a molecular weight of 249.29 g/mol. Its IUPAC name is 5-[4-(dimethylamino)but-2-enoylamino]pyridin-1-ium-2-carboxamide.
| Compound Name | 5-[4-(dimethylamino)but-2-enoylamino]pyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 163886350 |
| Molecular Formula | C12H17N4O2+ |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 5-[4-(dimethylamino)but-2-enoylamino]pyridin-1-ium-2-carboxamide |
| SMILES | CN(C)CC=CC(=O)Nc1ccc(C(N)=O)[nH+]c1 |
| InChI | InChI=1S/C12H16N4O2/c1-16(2)7-3-4-11(17)15-9-5-6-10(12(13)18)14-8-9/h3-6,8H,7H2,1-2H3,(H2,13,18)(H,15,17)/p+1 |
| InChIKey | PXQRXYKHJBYPLF-UHFFFAOYSA-O |
| XLogP | -0.34 |
| TPSA | 89.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|