About phenyliodanuidylbenzene;trifluoroborane;fluoride
phenyliodanuidylbenzene;trifluoroborane;fluoride (PubChem CID 163886922) has the molecular formula C12H10BF4I-2
and a molecular weight of 367.92 g/mol. Its IUPAC name is phenyliodanuidylbenzene;trifluoroborane;fluoride.
Molecular Properties
| Compound Name | phenyliodanuidylbenzene;trifluoroborane;fluoride |
| PubChem CID | 163886922 |
| Molecular Formula | C12H10BF4I-2 |
| Molecular Weight | 367.92 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | phenyliodanuidylbenzene;trifluoroborane;fluoride |
| SMILES | FB(F)F.[F-].c1ccc([I-]c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10I.BF3.FH/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2-1(3)4;/h1-10H;;1H/q-1;;/p-1 |
| InChIKey | ZASQYFVXBGYWNS-UHFFFAOYSA-M |
| XLogP | -2.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.92 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze phenyliodanuidylbenzene;trifluoroborane;fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyliodanuidylbenzene;trifluoroborane;fluoride?
The IUPAC name of phenyliodanuidylbenzene;trifluoroborane;fluoride (CID 163886922) is phenyliodanuidylbenzene;trifluoroborane;fluoride.
What is the SMILES notation for phenyliodanuidylbenzene;trifluoroborane;fluoride?
The canonical SMILES for phenyliodanuidylbenzene;trifluoroborane;fluoride is FB(F)F.[F-].c1ccc([I-]c2ccccc2)cc1.
What is the InChIKey of phenyliodanuidylbenzene;trifluoroborane;fluoride?
The InChIKey is ZASQYFVXBGYWNS-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H10I.BF3.FH/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2-1(3)4;/h1-10H;;1H/q-1;;/p-1.
What are the key properties of phenyliodanuidylbenzene;trifluoroborane;fluoride?
phenyliodanuidylbenzene;trifluoroborane;fluoride has a molecular weight of 367.92 g/mol, XLogP of -2.30, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for phenyliodanuidylbenzene;trifluoroborane;fluoride is sourced from PubChem (CID 163886922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).