C16H24 — CID 163889773
1-butan-2-yl-1,3,3-trimethyl-2H-indene (PubChem CID 163889773) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is 1-butan-2-yl-1,3,3-trimethyl-2H-indene.
| Compound Name | 1-butan-2-yl-1,3,3-trimethyl-2H-indene |
|---|---|
| PubChem CID | 163889773 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 1-butan-2-yl-1,3,3-trimethyl-2H-indene |
| SMILES | CCC(C)C1(C)CC(C)(C)c2ccccc21 |
| InChI | InChI=1S/C16H24/c1-6-12(2)16(5)11-15(3,4)13-9-7-8-10-14(13)16/h7-10,12H,6,11H2,1-5H3 |
| InChIKey | QAOBROXQSOECAN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |