C28H21N3O2 — CID 163892373
4-(N-propan-2-ylanilino)-1,11-diazapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15,17,19-nonaene-8,14-dione (PubChem CID 163892373) has the molecular formula C28H21N3O2 and a molecular weight of 431.50 g/mol. Its IUPAC name is 4-(N-propan-2-ylanilino)-1,11-diazapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15,17,19-nonaene-8,14-dione.
| Compound Name | 4-(N-propan-2-ylanilino)-1,11-diazapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15,17,19-nonaene-8,14-dione |
|---|---|
| PubChem CID | 163892373 |
| Molecular Formula | C28H21N3O2 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 4-(N-propan-2-ylanilino)-1,11-diazapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15,17,19-nonaene-8,14-dione |
| SMILES | CC(C)N(c1ccccc1)c1ccc2c(=O)c3cncc4c(=O)c5ccccc5n(c2c1)c43 |
| InChI | InChI=1S/C28H21N3O2/c1-17(2)30(18-8-4-3-5-9-18)19-12-13-21-25(14-19)31-24-11-7-6-10-20(24)27(32)22-15-29-16-23(26(22)31)28(21)33/h3-17H,1-2H3 |
| InChIKey | QCQIKOJXRPGZIT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|