C34H23N3O2 — CID 164984799
17-isocyano-4-[naphthalen-1-yl(propan-2-yl)amino]-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene-8,14-dione (PubChem CID 164984799) has the molecular formula C34H23N3O2 and a molecular weight of 505.58 g/mol. Its IUPAC name is 17-isocyano-4-[naphthalen-1-yl(propan-2-yl)amino]-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene-8,14-dione.
| Compound Name | 17-isocyano-4-[naphthalen-1-yl(propan-2-yl)amino]-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene-8,14-dione |
|---|---|
| PubChem CID | 164984799 |
| Molecular Formula | C34H23N3O2 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | 17-isocyano-4-[naphthalen-1-yl(propan-2-yl)amino]-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene-8,14-dione |
| SMILES | [C-]#[N+]c1ccc2c(c1)c(=O)c1cccc3c(=O)c4ccc(N(c5cccc6ccccc56)C(C)C)cc4n2c13 |
| InChI | InChI=1S/C34H23N3O2/c1-20(2)36(29-13-6-9-21-8-4-5-10-24(21)29)23-15-16-25-31(19-23)37-30-17-14-22(35-3)18-28(30)34(39)27-12-7-11-26(32(27)37)33(25)38/h4-20H,1-2H3 |
| InChIKey | IIILVMHJQQUMGH-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|