C33H24N2OS — CID 163929299
4-(N-(1-methylcyclohexa-2,4-dien-1-yl)anilino)-14-sulfanylidene-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15,17,19-nonaen-8-one (PubChem CID 163929299) has the molecular formula C33H24N2OS and a molecular weight of 496.64 g/mol. Its IUPAC name is 4-(N-(1-methylcyclohexa-2,4-dien-1-yl)anilino)-14-sulfanylidene-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15,17,19-nonaen-8-one.
| Compound Name | 4-(N-(1-methylcyclohexa-2,4-dien-1-yl)anilino)-14-sulfanylidene-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15,17,19-nonaen-8-one |
|---|---|
| PubChem CID | 163929299 |
| Molecular Formula | C33H24N2OS |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | 4-(N-(1-methylcyclohexa-2,4-dien-1-yl)anilino)-14-sulfanylidene-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15,17,19-nonaen-8-one |
| SMILES | CC1(N(c2ccccc2)c2ccc3c(=O)c4cccc5c(=S)c6ccccc6n(c3c2)c45)C=CC=CC1 |
| InChI | InChI=1S/C33H24N2OS/c1-33(19-8-3-9-20-33)35(22-11-4-2-5-12-22)23-17-18-24-29(21-23)34-28-16-7-6-13-25(28)32(37)27-15-10-14-26(30(27)34)31(24)36/h2-19,21H,20H2,1H3 |
| InChIKey | RHICEKSFYUQRDS-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|