C14H9NO2 — CID 163894235
2,3-dihydro-[1]benzofuro[2,3-f]indol-1-one (PubChem CID 163894235) has the molecular formula C14H9NO2 and a molecular weight of 223.23 g/mol. Its IUPAC name is 2,3-dihydro-[1]benzofuro[2,3-f]indol-1-one.
| Compound Name | 2,3-dihydro-[1]benzofuro[2,3-f]indol-1-one |
|---|---|
| PubChem CID | 163894235 |
| Molecular Formula | C14H9NO2 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 2,3-dihydro-[1]benzofuro[2,3-f]indol-1-one |
| SMILES | O=C1CNc2cc3c(cc21)oc1ccccc13 |
| InChI | InChI=1S/C14H9NO2/c16-12-7-15-11-5-9-8-3-1-2-4-13(8)17-14(9)6-10(11)12/h1-6,15H,7H2 |
| InChIKey | QEEQMWZLWIXQBE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |