C20H31N3O2 — CID 163894410
(1S)-1-cyclopentyl-1-[[hydroxy-[4-(4-methylpiperazin-1-yl)phenyl]methyl]amino]propan-2-one (PubChem CID 163894410) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is (1S)-1-cyclopentyl-1-[[hydroxy-[4-(4-methylpiperazin-1-yl)phenyl]methyl]amino]propan-2-one.
| Compound Name | (1S)-1-cyclopentyl-1-[[hydroxy-[4-(4-methylpiperazin-1-yl)phenyl]methyl]amino]propan-2-one |
|---|---|
| PubChem CID | 163894410 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | (1S)-1-cyclopentyl-1-[[hydroxy-[4-(4-methylpiperazin-1-yl)phenyl]methyl]amino]propan-2-one |
| SMILES | CC(=O)[C@@H](NC(O)c1ccc(N2CCN(C)CC2)cc1)C1CCCC1 |
| InChI | InChI=1S/C20H31N3O2/c1-15(24)19(16-5-3-4-6-16)21-20(25)17-7-9-18(10-8-17)23-13-11-22(2)12-14-23/h7-10,16,19-21,25H,3-6,11-14H2,1-2H3/t19-,20?/m1/s1 |
| InChIKey | QEIYZVWHBDYCOY-FIWHBWSRSA-N |
| XLogP | 2.17 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|