C10H23N7O2 — CID 163895940
1-amino-3-[4-(hydrazinecarbonylamino)-6-imino-2,4-dimethylhexan-2-yl]urea (PubChem CID 163895940) has the molecular formula C10H23N7O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 1-amino-3-[4-(hydrazinecarbonylamino)-6-imino-2,4-dimethylhexan-2-yl]urea.
| Compound Name | 1-amino-3-[4-(hydrazinecarbonylamino)-6-imino-2,4-dimethylhexan-2-yl]urea |
|---|---|
| PubChem CID | 163895940 |
| Molecular Formula | C10H23N7O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | 1-amino-3-[4-(hydrazinecarbonylamino)-6-imino-2,4-dimethylhexan-2-yl]urea |
| SMILES | [H]/N=C/CC(C)(CC(C)(C)NC(=O)NN)NC(=O)NN |
| InChI | InChI=1S/C10H23N7O2/c1-9(2,14-7(18)16-12)6-10(3,4-5-11)15-8(19)17-13/h5,11H,4,6,12-13H2,1-3H3,(H2,14,16,18)(H2,15,17,19)/b11-5+ |
| InChIKey | QFPLVTOIJZDTIK-VZUCSPMQSA-N |
| XLogP | -0.70 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|