C10H16N2 — CID 163901863
(2,4-dimethylcyclohexa-2,4-dien-1-yl)methyl-methyldiazene (PubChem CID 163901863) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is (2,4-dimethylcyclohexa-2,4-dien-1-yl)methyl-methyldiazene.
| Compound Name | (2,4-dimethylcyclohexa-2,4-dien-1-yl)methyl-methyldiazene |
|---|---|
| PubChem CID | 163901863 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (2,4-dimethylcyclohexa-2,4-dien-1-yl)methyl-methyldiazene |
| SMILES | C/N=N/CC1CC=C(C)C=C1C |
| InChI | InChI=1S/C10H16N2/c1-8-4-5-10(7-12-11-3)9(2)6-8/h4,6,10H,5,7H2,1-3H3/b12-11+ |
| InChIKey | QKNRSDDDWTWYIY-VAWYXSNFSA-N |
| XLogP | 2.98 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|