C9H12N2 — CID 91357672
8-methyl-1,4,4a,5-tetrahydrophthalazine (PubChem CID 91357672) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 8-methyl-1,4,4a,5-tetrahydrophthalazine.
| Compound Name | 8-methyl-1,4,4a,5-tetrahydrophthalazine |
|---|---|
| PubChem CID | 91357672 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 8-methyl-1,4,4a,5-tetrahydrophthalazine |
| SMILES | CC1=C2CN=NCC2CC=C1 |
| InChI | InChI=1S/C9H12N2/c1-7-3-2-4-8-5-10-11-6-9(7)8/h2-3,8H,4-6H2,1H3 |
| InChIKey | QEXBGAQWYZHYNH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |