C12H16N2 — CID 144612678
1,8a-dihydrophthalazine;but-2-ene (PubChem CID 144612678) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 1,8a-dihydrophthalazine;but-2-ene.
| Compound Name | 1,8a-dihydrophthalazine;but-2-ene |
|---|---|
| PubChem CID | 144612678 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 1,8a-dihydrophthalazine;but-2-ene |
| SMILES | C1=CC2=CN=NCC2C=C1.CC=CC |
| InChI | InChI=1S/C8H8N2.C4H8/c1-2-4-8-6-10-9-5-7(8)3-1;1-3-4-2/h1-5,8H,6H2;3-4H,1-2H3 |
| InChIKey | QGXOQZVGKDYJAV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|