C29H38I2N3O7- — CID 163904914
(4aR,5aS,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-4a-iodo-9-(3-methylbutyliodanuidylmethyl)-3,12-dioxo-4,5,5a,6-tetrahydrotetracene-2-carboxamide (PubChem CID 163904914) has the molecular formula C29H38I2N3O7- and a molecular weight of 794.44 g/mol. Its IUPAC name is (4aR,5aS,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-4a-iodo-9-(3-methylbutyliodanuidylmethyl)-3,12-dioxo-4,5,5a,6-tetrahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5aS,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-4a-iodo-9-(3-methylbutyliodanuidylmethyl)-3,12-dioxo-4,5,5a,6-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 163904914 |
| Molecular Formula | C29H38I2N3O7- |
| Molecular Weight | 794.44 g/mol |
| Exact Mass | 794.08 |
| IUPAC Name | (4aR,5aS,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-4a-iodo-9-(3-methylbutyliodanuidylmethyl)-3,12-dioxo-4,5,5a,6-tetrahydrotetracene-2-carboxamide |
| SMILES | CC(C)CC[I-]Cc1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C(N(C)C)[C@]3(I)C[C@@H]1C2 |
| InChI | InChI=1S/C29H38I2N3O7/c1-13(2)7-8-31-12-15-10-17(33(3)4)16-9-14-11-28(30)24(34(5)6)23(37)20(27(32)40)26(39)29(28,41)25(38)18(14)22(36)19(16)21(15)35/h10,13-14,24,35-36,39,41H,7-9,11-12H2,1-6H3,(H2,32,40)/q-1/t14-,24?,28+,29-/m0/s1 |
| InChIKey | OFTVBHMLGYNPRR-OPRQQMABSA-N |
| XLogP | -0.78 |
| TPSA | 164.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.44 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|