C16H15BrClNO3 — CID 163907489
ethyl 3-(4-bromo-2-chloroanilino)-4-ethenyl-5-methylfuran-2-carboxylate (PubChem CID 163907489) has the molecular formula C16H15BrClNO3 and a molecular weight of 384.66 g/mol. Its IUPAC name is ethyl 3-(4-bromo-2-chloroanilino)-4-ethenyl-5-methylfuran-2-carboxylate.
| Compound Name | ethyl 3-(4-bromo-2-chloroanilino)-4-ethenyl-5-methylfuran-2-carboxylate |
|---|---|
| PubChem CID | 163907489 |
| Molecular Formula | C16H15BrClNO3 |
| Molecular Weight | 384.66 g/mol |
| Exact Mass | 382.99 |
| IUPAC Name | ethyl 3-(4-bromo-2-chloroanilino)-4-ethenyl-5-methylfuran-2-carboxylate |
| SMILES | C=Cc1c(C)oc(C(=O)OCC)c1Nc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C16H15BrClNO3/c1-4-11-9(3)22-15(16(20)21-5-2)14(11)19-13-7-6-10(17)8-12(13)18/h4,6-8,19H,1,5H2,2-3H3 |
| InChIKey | QPFRZXRXFXAWDX-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.66 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |