C25H36 — CID 163910828
2,7-ditert-butyl-4,4,9,9-tetramethyl-4aH-fluorene (PubChem CID 163910828) has the molecular formula C25H36 and a molecular weight of 336.56 g/mol. Its IUPAC name is 2,7-ditert-butyl-4,4,9,9-tetramethyl-4aH-fluorene.
| Compound Name | 2,7-ditert-butyl-4,4,9,9-tetramethyl-4aH-fluorene |
|---|---|
| PubChem CID | 163910828 |
| Molecular Formula | C25H36 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | 2,7-ditert-butyl-4,4,9,9-tetramethyl-4aH-fluorene |
| SMILES | CC(C)(C)C1=CC(C)(C)C2C(=C1)C(C)(C)c1cc(C(C)(C)C)ccc12 |
| InChI | InChI=1S/C25H36/c1-22(2,3)16-11-12-18-19(13-16)25(9,10)20-14-17(23(4,5)6)15-24(7,8)21(18)20/h11-15,21H,1-10H3 |
| InChIKey | QRXUYBCHLGZMHB-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |