C23H33NS — CID 144876081
2,7-ditert-butyl-9,9-dimethyl-4a,9a-dihydrothioxanthen-4-amine (PubChem CID 144876081) has the molecular formula C23H33NS and a molecular weight of 355.59 g/mol. Its IUPAC name is 2,7-ditert-butyl-9,9-dimethyl-4a,9a-dihydrothioxanthen-4-amine.
| Compound Name | 2,7-ditert-butyl-9,9-dimethyl-4a,9a-dihydrothioxanthen-4-amine |
|---|---|
| PubChem CID | 144876081 |
| Molecular Formula | C23H33NS |
| Molecular Weight | 355.59 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 2,7-ditert-butyl-9,9-dimethyl-4a,9a-dihydrothioxanthen-4-amine |
| SMILES | CC(C)(C)C1=CC2C(Sc3ccc(C(C)(C)C)cc3C2(C)C)C(N)=C1 |
| InChI | InChI=1S/C23H33NS/c1-21(2,3)14-9-10-19-16(11-14)23(7,8)17-12-15(22(4,5)6)13-18(24)20(17)25-19/h9-13,17,20H,24H2,1-8H3 |
| InChIKey | AAUFUGWGDGIIJD-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.59 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |