C14H18NOSi — CID 163912857
CID 163912857 (PubChem CID 163912857) has the molecular formula C14H18NOSi and a molecular weight of 244.39 g/mol.
| Compound Name | CID 163912857 |
|---|---|
| PubChem CID | 163912857 |
| Molecular Formula | C14H18NOSi |
| Molecular Weight | 244.39 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | — |
| SMILES | Cc1cccc2c1[C@]([Si])([C@H]1CCCN1)OCC2 |
| InChI | InChI=1S/C14H18NOSi/c1-10-4-2-5-11-7-9-16-14(17,13(10)11)12-6-3-8-15-12/h2,4-5,12,15H,3,6-9H2,1H3/t12-,14-/m1/s1 |
| InChIKey | DAXMRZFEOCFLPQ-TZMCWYRMSA-N |
| XLogP | 1.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|