C15H21NOS — CID 165065763
(1S)-3,3-dimethyl-1-[(2R)-pyrrolidin-2-yl]-4H-isochromene-1-thiol (PubChem CID 165065763) has the molecular formula C15H21NOS and a molecular weight of 263.41 g/mol. Its IUPAC name is (1S)-3,3-dimethyl-1-[(2R)-pyrrolidin-2-yl]-4H-isochromene-1-thiol.
| Compound Name | (1S)-3,3-dimethyl-1-[(2R)-pyrrolidin-2-yl]-4H-isochromene-1-thiol |
|---|---|
| PubChem CID | 165065763 |
| Molecular Formula | C15H21NOS |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | (1S)-3,3-dimethyl-1-[(2R)-pyrrolidin-2-yl]-4H-isochromene-1-thiol |
| SMILES | CC1(C)Cc2ccccc2[C@](S)([C@H]2CCCN2)O1 |
| InChI | InChI=1S/C15H21NOS/c1-14(2)10-11-6-3-4-7-12(11)15(18,17-14)13-8-5-9-16-13/h3-4,6-7,13,16,18H,5,8-10H2,1-2H3/t13-,15+/m1/s1 |
| InChIKey | RXVZCYMLQNYRAH-HIFRSBDPSA-N |
| XLogP | 2.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|