C17H27N — CID 54557495
ethane;(1S,9R)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene (PubChem CID 54557495) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is ethane;(1S,9R)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene.
| Compound Name | ethane;(1S,9R)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene |
|---|---|
| PubChem CID | 54557495 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | ethane;(1S,9R)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene |
| SMILES | CC.CC1(C)[C@H]2Cc3ccccc3[C@]1(C)CCN2 |
| InChI | InChI=1S/C15H21N.C2H6/c1-14(2)13-10-11-6-4-5-7-12(11)15(14,3)8-9-16-13;1-2/h4-7,13,16H,8-10H2,1-3H3;1-2H3/t13-,15+;/m1./s1 |
| InChIKey | ZOENXMKXYJSFOW-PBCQUBLHSA-N |
| XLogP | 3.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |