C18H23N — CID 90259681
(1S,9R)-17-azapentacyclo[7.5.3.210,13.01,10.02,7]nonadeca-2,4,6-triene (PubChem CID 90259681) has the molecular formula C18H23N and a molecular weight of 253.39 g/mol. Its IUPAC name is (1S,9R)-17-azapentacyclo[7.5.3.210,13.01,10.02,7]nonadeca-2,4,6-triene.
| Compound Name | (1S,9R)-17-azapentacyclo[7.5.3.210,13.01,10.02,7]nonadeca-2,4,6-triene |
|---|---|
| PubChem CID | 90259681 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | (1S,9R)-17-azapentacyclo[7.5.3.210,13.01,10.02,7]nonadeca-2,4,6-triene |
| SMILES | c1ccc2c(c1)C[C@H]1NCC[C@@]23CC2CCC13CC2 |
| InChI | InChI=1S/C18H23N/c1-2-4-15-14(3-1)11-16-17-7-5-13(6-8-17)12-18(15,17)9-10-19-16/h1-4,13,16,19H,5-12H2/t13?,16-,17?,18-/m1/s1 |
| InChIKey | YJVYQNDLYWMDHN-YJVWJLORSA-N |
| XLogP | 3.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |