C21H27NO2 — CID 169082177
1-[(1R,9R,10S)-13-methoxy-17-azapentacyclo[7.5.3.210,13.01,10.02,7]nonadeca-2,4,6,18-tetraen-12-yl]ethanol (PubChem CID 169082177) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is 1-[(1R,9R,10S)-13-methoxy-17-azapentacyclo[7.5.3.210,13.01,10.02,7]nonadeca-2,4,6,18-tetraen-12-yl]ethanol.
| Compound Name | 1-[(1R,9R,10S)-13-methoxy-17-azapentacyclo[7.5.3.210,13.01,10.02,7]nonadeca-2,4,6,18-tetraen-12-yl]ethanol |
|---|---|
| PubChem CID | 169082177 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 1-[(1R,9R,10S)-13-methoxy-17-azapentacyclo[7.5.3.210,13.01,10.02,7]nonadeca-2,4,6,18-tetraen-12-yl]ethanol |
| SMILES | COC12C=C[C@]3(CC1C(C)O)[C@H]1Cc4ccccc4[C@@]3(CCN1)C2 |
| InChI | InChI=1S/C21H27NO2/c1-14(23)17-12-19-7-8-21(17,24-2)13-20(19)9-10-22-18(19)11-15-5-3-4-6-16(15)20/h3-8,14,17-18,22-23H,9-13H2,1-2H3/t14?,17?,18-,19+,20-,21?/m1/s1 |
| InChIKey | HSPFPZSLYOWXAH-PUCAWAGLSA-N |
| XLogP | 2.57 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|