C70H88IO8- — CID 163914143
CID 163914143 (PubChem CID 163914143) has the molecular formula C70H88IO8- and a molecular weight of 1184.37 g/mol.
| Compound Name | CID 163914143 |
|---|---|
| PubChem CID | 163914143 |
| Molecular Formula | C70H88IO8- |
| Molecular Weight | 1184.37 g/mol |
| Exact Mass | 1183.55 |
| IUPAC Name | — |
| SMILES | CCC(C)(C)Oc1ccc(C(C)(C)c2ccc(OC(=O)c3ccc(C(=O)C(C)(CC)C(C)(CC)Oc4ccc([I-](c5ccc(OC(=O)c6cccc(C(=O)C(C)(C)C)c6)c(C)c5)(C(C)C)C(C)C)cc4C)cc3)c(C)c2)cc1C |
| InChI | InChI=1S/C70H88IO8/c1-21-67(15,16)78-60-36-32-55(40-47(60)9)68(17,18)54-31-35-58(46(8)39-54)76-64(74)51-29-27-50(28-30-51)63(73)69(19,22-2)70(20,23-3)79-61-38-34-57(42-49(61)11)71(44(4)5,45(6)7)56-33-37-59(48(10)41-56)77-65(75)53-26-24-25-52(43-53)62(72)66(12,13)14/h24-45H,21-23H2,1-20H3/q-1 |
| InChIKey | FLZVQRUDQOYVOA-UHFFFAOYSA-N |
| XLogP | 14.34 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1184.37 |
| LogP ≤ 5 | 14.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|