C16H20N2O — CID 163915315
4-(4a,5,8,8a-tetrahydroquinolin-8-yloxy)-5-methylcyclohexa-1,5-dien-1-amine (PubChem CID 163915315) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 4-(4a,5,8,8a-tetrahydroquinolin-8-yloxy)-5-methylcyclohexa-1,5-dien-1-amine.
| Compound Name | 4-(4a,5,8,8a-tetrahydroquinolin-8-yloxy)-5-methylcyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 163915315 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 4-(4a,5,8,8a-tetrahydroquinolin-8-yloxy)-5-methylcyclohexa-1,5-dien-1-amine |
| SMILES | CC1=CC(N)=CCC1OC1C=CCC2C=CC=NC21 |
| InChI | InChI=1S/C16H20N2O/c1-11-10-13(17)7-8-14(11)19-15-6-2-4-12-5-3-9-18-16(12)15/h2-3,5-7,9-10,12,14-16H,4,8,17H2,1H3 |
| InChIKey | QVSQQTPIBIDHSK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|