C23H34NO5- — CID 163915583
[(3S,9S,10R,13S,14S)-6-[hydroxy(oxido)amino]-9,10,13,14-tetramethyl-17-oxo-1,2,3,4,7,8,11,12,15,16-decahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 163915583) has the molecular formula C23H34NO5- and a molecular weight of 404.53 g/mol. Its IUPAC name is [(3S,9S,10R,13S,14S)-6-[hydroxy(oxido)amino]-9,10,13,14-tetramethyl-17-oxo-1,2,3,4,7,8,11,12,15,16-decahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,9S,10R,13S,14S)-6-[hydroxy(oxido)amino]-9,10,13,14-tetramethyl-17-oxo-1,2,3,4,7,8,11,12,15,16-decahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 163915583 |
| Molecular Formula | C23H34NO5- |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | [(3S,9S,10R,13S,14S)-6-[hydroxy(oxido)amino]-9,10,13,14-tetramethyl-17-oxo-1,2,3,4,7,8,11,12,15,16-decahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=C(N([O-])O)CC3[C@]2(C)CC[C@]2(C)C(=O)CC[C@@]32C)C1 |
| InChI | InChI=1S/C23H34NO5/c1-14(25)29-15-6-8-20(2)16(12-15)17(24(27)28)13-18-21(3)9-7-19(26)23(21,5)11-10-22(18,20)4/h15,18,27H,6-13H2,1-5H3/q-1/t15-,18?,20-,21-,22-,23+/m0/s1 |
| InChIKey | UNZWKTOOWSOISM-FTNFKNQTSA-N |
| XLogP | 4.75 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|