C22H33NO3 — CID 118858322
(3S,8R,9S,10R,13S,14S)-3,9,10,13,14-pentamethyl-6-nitro-1,2,3,4,7,8,11,12,15,16-decahydrocyclopenta[a]phenanthren-17-one (PubChem CID 118858322) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14S)-3,9,10,13,14-pentamethyl-6-nitro-1,2,3,4,7,8,11,12,15,16-decahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (3S,8R,9S,10R,13S,14S)-3,9,10,13,14-pentamethyl-6-nitro-1,2,3,4,7,8,11,12,15,16-decahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 118858322 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S)-3,9,10,13,14-pentamethyl-6-nitro-1,2,3,4,7,8,11,12,15,16-decahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C[C@H]1CC[C@@]2(C)C(=C([N+](=O)[O-])C[C@@H]3[C@]2(C)CC[C@]2(C)C(=O)CC[C@@]32C)C1 |
| InChI | InChI=1S/C22H33NO3/c1-14-6-8-19(2)15(12-14)16(23(25)26)13-17-20(3)9-7-18(24)22(20,5)11-10-21(17,19)4/h14,17H,6-13H2,1-5H3/t14-,17-,19-,20-,21-,22+/m0/s1 |
| InChIKey | LSQNPGLCRFCUBU-FCGMOTLLSA-N |
| XLogP | 5.54 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|