C7H13N5O2S — CID 163916214
4,6-dimethyl-2-[(2-sulfinohydrazinyl)methylamino]pyrimidine (PubChem CID 163916214) has the molecular formula C7H13N5O2S and a molecular weight of 231.28 g/mol. Its IUPAC name is 4,6-dimethyl-2-[(2-sulfinohydrazinyl)methylamino]pyrimidine.
| Compound Name | 4,6-dimethyl-2-[(2-sulfinohydrazinyl)methylamino]pyrimidine |
|---|---|
| PubChem CID | 163916214 |
| Molecular Formula | C7H13N5O2S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 4,6-dimethyl-2-[(2-sulfinohydrazinyl)methylamino]pyrimidine |
| SMILES | Cc1cc(C)nc(NCNNS(=O)O)n1 |
| InChI | InChI=1S/C7H13N5O2S/c1-5-3-6(2)11-7(10-5)8-4-9-12-15(13)14/h3,9,12H,4H2,1-2H3,(H,13,14)(H,8,10,11) |
| InChIKey | ZDSOYMSJRSQPJQ-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 99.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|