C18H22N4O — CID 163916799
N,N-diethyl-2-(2-pyridin-4-ylbenzimidazol-1-yl)oxyethanamine (PubChem CID 163916799) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is N,N-diethyl-2-(2-pyridin-4-ylbenzimidazol-1-yl)oxyethanamine.
| Compound Name | N,N-diethyl-2-(2-pyridin-4-ylbenzimidazol-1-yl)oxyethanamine |
|---|---|
| PubChem CID | 163916799 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | N,N-diethyl-2-(2-pyridin-4-ylbenzimidazol-1-yl)oxyethanamine |
| SMILES | CCN(CC)CCOn1c(-c2ccncc2)nc2ccccc21 |
| InChI | InChI=1S/C18H22N4O/c1-3-21(4-2)13-14-23-22-17-8-6-5-7-16(17)20-18(22)15-9-11-19-12-10-15/h5-12H,3-4,13-14H2,1-2H3 |
| InChIKey | QWYUFBLIDFKZPC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |