C9H16O4S — CID 163919270
(5R)-5-(2-ethylsulfanyl-2-hydroxyethyl)-2,2-dimethyl-1,3-dioxolan-4-one (PubChem CID 163919270) has the molecular formula C9H16O4S and a molecular weight of 220.29 g/mol. Its IUPAC name is (5R)-5-(2-ethylsulfanyl-2-hydroxyethyl)-2,2-dimethyl-1,3-dioxolan-4-one.
| Compound Name | (5R)-5-(2-ethylsulfanyl-2-hydroxyethyl)-2,2-dimethyl-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 163919270 |
| Molecular Formula | C9H16O4S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | (5R)-5-(2-ethylsulfanyl-2-hydroxyethyl)-2,2-dimethyl-1,3-dioxolan-4-one |
| SMILES | CCSC(O)C[C@H]1OC(C)(C)OC1=O |
| InChI | InChI=1S/C9H16O4S/c1-4-14-7(10)5-6-8(11)13-9(2,3)12-6/h6-7,10H,4-5H2,1-3H3/t6-,7?/m1/s1 |
| InChIKey | QYZXJIPEADTLND-ULUSZKPHSA-N |
| XLogP | 1.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|