C35H35NO9 — CID 163920340
[9-cyano-7-[1-(3-prop-2-enoyloxypropoxy)ethoxy]-9H-fluoren-2-yl] 4-[3-(1-hydroxyprop-2-enoxy)propoxy]benzoate (PubChem CID 163920340) has the molecular formula C35H35NO9 and a molecular weight of 613.66 g/mol. Its IUPAC name is [9-cyano-7-[1-(3-prop-2-enoyloxypropoxy)ethoxy]-9H-fluoren-2-yl] 4-[3-(1-hydroxyprop-2-enoxy)propoxy]benzoate.
| Compound Name | [9-cyano-7-[1-(3-prop-2-enoyloxypropoxy)ethoxy]-9H-fluoren-2-yl] 4-[3-(1-hydroxyprop-2-enoxy)propoxy]benzoate |
|---|---|
| PubChem CID | 163920340 |
| Molecular Formula | C35H35NO9 |
| Molecular Weight | 613.66 g/mol |
| Exact Mass | 613.23 |
| IUPAC Name | [9-cyano-7-[1-(3-prop-2-enoyloxypropoxy)ethoxy]-9H-fluoren-2-yl] 4-[3-(1-hydroxyprop-2-enoxy)propoxy]benzoate |
| SMILES | C=CC(=O)OCCCOC(C)Oc1ccc2c(c1)C(C#N)c1cc(OC(=O)c3ccc(OCCCOC(O)C=C)cc3)ccc1-2 |
| InChI | InChI=1S/C35H35NO9/c1-4-33(37)42-18-6-16-40-23(3)44-26-12-14-28-29-15-13-27(21-31(29)32(22-36)30(28)20-26)45-35(39)24-8-10-25(11-9-24)41-17-7-19-43-34(38)5-2/h4-5,8-15,20-21,23,32,34,38H,1-2,6-7,16-19H2,3H3 |
| InChIKey | QZWWCIGYJHXMCG-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 133.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.66 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|