C13H11F3O — CID 163923607
(1R)-3-[4-(trifluoromethyl)phenyl]cyclohexa-2,4-dien-1-ol (PubChem CID 163923607) has the molecular formula C13H11F3O and a molecular weight of 240.22 g/mol. Its IUPAC name is (1R)-3-[4-(trifluoromethyl)phenyl]cyclohexa-2,4-dien-1-ol.
| Compound Name | (1R)-3-[4-(trifluoromethyl)phenyl]cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 163923607 |
| Molecular Formula | C13H11F3O |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | (1R)-3-[4-(trifluoromethyl)phenyl]cyclohexa-2,4-dien-1-ol |
| SMILES | O[C@H]1C=C(c2ccc(C(F)(F)F)cc2)C=CC1 |
| InChI | InChI=1S/C13H11F3O/c14-13(15,16)11-6-4-9(5-7-11)10-2-1-3-12(17)8-10/h1-2,4-8,12,17H,3H2/t12-/m1/s1 |
| InChIKey | RCOAMRURHZCRHH-GFCCVEGCSA-N |
| XLogP | 3.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |