C10H11IN5- — CID 163924279
CID 163924279 (PubChem CID 163924279) has the molecular formula C10H11IN5- and a molecular weight of 328.14 g/mol.
| Compound Name | CID 163924279 |
|---|---|
| PubChem CID | 163924279 |
| Molecular Formula | C10H11IN5- |
| Molecular Weight | 328.14 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | — |
| SMILES | Cn1cc(Nc2cc(C3C[I-]3)ncn2)cn1 |
| InChI | InChI=1S/C10H11IN5/c1-16-5-7(4-14-16)15-10-2-9(8-3-11-8)12-6-13-10/h2,4-6,8H,3H2,1H3,(H,12,13,15)/q-1 |
| InChIKey | FJPXURXZGWPIMR-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.14 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|