C21H25ClN4O2S — CID 163925573
2-amino-5-(5-chlorothiophen-2-yl)-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-4-oxopent-2-enamide (PubChem CID 163925573) has the molecular formula C21H25ClN4O2S and a molecular weight of 432.98 g/mol. Its IUPAC name is 2-amino-5-(5-chlorothiophen-2-yl)-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-4-oxopent-2-enamide.
| Compound Name | 2-amino-5-(5-chlorothiophen-2-yl)-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-4-oxopent-2-enamide |
|---|---|
| PubChem CID | 163925573 |
| Molecular Formula | C21H25ClN4O2S |
| Molecular Weight | 432.98 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 2-amino-5-(5-chlorothiophen-2-yl)-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-4-oxopent-2-enamide |
| SMILES | CN(C)C1CCN(c2ccc(NC(=O)C(N)=CC(=O)Cc3ccc(Cl)s3)cc2)C1 |
| InChI | InChI=1S/C21H25ClN4O2S/c1-25(2)16-9-10-26(13-16)15-5-3-14(4-6-15)24-21(28)19(23)12-17(27)11-18-7-8-20(22)29-18/h3-8,12,16H,9-11,13,23H2,1-2H3,(H,24,28) |
| InChIKey | YFXDSUTZLQIBJI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.98 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|