C11H13FN2O2 — CID 163925783
[(3R,4S)-3-amino-4-fluoropyrrolidin-1-yl] benzoate (PubChem CID 163925783) has the molecular formula C11H13FN2O2 and a molecular weight of 224.24 g/mol. Its IUPAC name is [(3R,4S)-3-amino-4-fluoropyrrolidin-1-yl] benzoate.
| Compound Name | [(3R,4S)-3-amino-4-fluoropyrrolidin-1-yl] benzoate |
|---|---|
| PubChem CID | 163925783 |
| Molecular Formula | C11H13FN2O2 |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | [(3R,4S)-3-amino-4-fluoropyrrolidin-1-yl] benzoate |
| SMILES | N[C@@H]1CN(OC(=O)c2ccccc2)C[C@@H]1F |
| InChI | InChI=1S/C11H13FN2O2/c12-9-6-14(7-10(9)13)16-11(15)8-4-2-1-3-5-8/h1-5,9-10H,6-7,13H2/t9-,10+/m0/s1 |
| InChIKey | REIKWGMXIQBURK-VHSXEESVSA-N |
| XLogP | 0.74 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |