C22H34BrNO3 — CID 163930030
1-[(3R,9R,13S,14R,17S)-8-amino-3-hydroxy-3-(methoxymethyl)-13-methyl-1,2,4,7,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-bromoethanone (PubChem CID 163930030) has the molecular formula C22H34BrNO3 and a molecular weight of 440.42 g/mol. Its IUPAC name is 1-[(3R,9R,13S,14R,17S)-8-amino-3-hydroxy-3-(methoxymethyl)-13-methyl-1,2,4,7,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-bromoethanone.
| Compound Name | 1-[(3R,9R,13S,14R,17S)-8-amino-3-hydroxy-3-(methoxymethyl)-13-methyl-1,2,4,7,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-bromoethanone |
|---|---|
| PubChem CID | 163930030 |
| Molecular Formula | C22H34BrNO3 |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 1-[(3R,9R,13S,14R,17S)-8-amino-3-hydroxy-3-(methoxymethyl)-13-methyl-1,2,4,7,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-bromoethanone |
| SMILES | COC[C@@]1(O)CCC2C(=CCC3(N)[C@@H]2CC[C@]2(C)[C@@H](C(=O)CBr)CC[C@@H]32)C1 |
| InChI | InChI=1S/C22H34BrNO3/c1-20-8-7-16-15-6-9-21(26,13-27-2)11-14(15)5-10-22(16,24)19(20)4-3-17(20)18(25)12-23/h5,15-17,19,26H,3-4,6-13,24H2,1-2H3/t15?,16-,17-,19-,20-,21-,22?/m1/s1 |
| InChIKey | RHWVSLPJGKQVBG-ZMWBYNAXSA-N |
| XLogP | 3.60 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|