C21H31BrF2O2 — CID 123913789
2-bromo-1-[5-[4-(difluoromethyl)-2-ethylidene-4-hydroxycyclohexyl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]ethanone (PubChem CID 123913789) has the molecular formula C21H31BrF2O2 and a molecular weight of 433.38 g/mol. Its IUPAC name is 2-bromo-1-[5-[4-(difluoromethyl)-2-ethylidene-4-hydroxycyclohexyl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]ethanone.
| Compound Name | 2-bromo-1-[5-[4-(difluoromethyl)-2-ethylidene-4-hydroxycyclohexyl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]ethanone |
|---|---|
| PubChem CID | 123913789 |
| Molecular Formula | C21H31BrF2O2 |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 2-bromo-1-[5-[4-(difluoromethyl)-2-ethylidene-4-hydroxycyclohexyl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]ethanone |
| SMILES | CC=C1CC(O)(C(F)F)CCC1C1CCC2(C)C(CCC2C(=O)CBr)C1 |
| InChI | InChI=1S/C21H31BrF2O2/c1-3-13-11-21(26,19(23)24)9-7-16(13)14-6-8-20(2)15(10-14)4-5-17(20)18(25)12-22/h3,14-17,19,26H,4-12H2,1-2H3 |
| InChIKey | TZEWPFXNFHLBNB-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|