C22H32BrFO2 — CID 170201756
2-bromo-1-[(8R,9S,10R,13S,14S,17S)-6-fluoro-2-(1-hydroxyethyl)-13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 170201756) has the molecular formula C22H32BrFO2 and a molecular weight of 427.40 g/mol. Its IUPAC name is 2-bromo-1-[(8R,9S,10R,13S,14S,17S)-6-fluoro-2-(1-hydroxyethyl)-13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 2-bromo-1-[(8R,9S,10R,13S,14S,17S)-6-fluoro-2-(1-hydroxyethyl)-13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 170201756 |
| Molecular Formula | C22H32BrFO2 |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 2-bromo-1-[(8R,9S,10R,13S,14S,17S)-6-fluoro-2-(1-hydroxyethyl)-13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC(O)C1CCC2=C(F)C[C@@H]3[C@H](CC[C@]4(C)[C@@H](C(=O)CBr)CC[C@@H]34)[C@H]2C1 |
| InChI | InChI=1S/C22H32BrFO2/c1-12(25)13-3-4-15-16(9-13)14-7-8-22(2)18(17(14)10-20(15)24)5-6-19(22)21(26)11-23/h12-14,16-19,25H,3-11H2,1-2H3/t12?,13?,14-,16-,17-,18+,19-,22+/m1/s1 |
| InChIKey | MPUHGRFCKACJNE-DPAVAREMSA-N |
| XLogP | 5.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|