C10H11NOS — CID 163932236
4-methoxy-2-phenyl-4,5-dihydro-1,3-thiazole (PubChem CID 163932236) has the molecular formula C10H11NOS and a molecular weight of 193.27 g/mol. Its IUPAC name is 4-methoxy-2-phenyl-4,5-dihydro-1,3-thiazole.
| Compound Name | 4-methoxy-2-phenyl-4,5-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 163932236 |
| Molecular Formula | C10H11NOS |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 4-methoxy-2-phenyl-4,5-dihydro-1,3-thiazole |
| SMILES | COC1CSC(c2ccccc2)=N1 |
| InChI | InChI=1S/C10H11NOS/c1-12-9-7-13-10(11-9)8-5-3-2-4-6-8/h2-6,9H,7H2,1H3 |
| InChIKey | RJQXEJFTRBECSE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |